C18H16N4O5 — CID 143344899
methyl 4-[[[4-(1-hydroxyethenyl)-6-oxo-7H-imidazo[1,5-a]pyrimidine-2-carbonyl]amino]methyl]benzoate (PubChem CID 143344899) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is methyl 4-[[[4-(1-hydroxyethenyl)-6-oxo-7H-imidazo[1,5-a]pyrimidine-2-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[4-(1-hydroxyethenyl)-6-oxo-7H-imidazo[1,5-a]pyrimidine-2-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 143344899 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | methyl 4-[[[4-(1-hydroxyethenyl)-6-oxo-7H-imidazo[1,5-a]pyrimidine-2-carbonyl]amino]methyl]benzoate |
| SMILES | C=C(O)c1cc(C(=O)NCc2ccc(C(=O)OC)cc2)nc2c[nH]c(=O)n12 |
| InChI | InChI=1S/C18H16N4O5/c1-10(23)14-7-13(21-15-9-20-18(26)22(14)15)16(24)19-8-11-3-5-12(6-4-11)17(25)27-2/h3-7,9,23H,1,8H2,2H3,(H,19,24)(H,20,26) |
| InChIKey | OYKIZOYCJSLRFK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|