C10H15F2N — CID 143345041
(Z)-1,2-difluoro-2-methyl-N-[(Z)-prop-1-enyl]hex-4-en-3-imine (PubChem CID 143345041) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (Z)-1,2-difluoro-2-methyl-N-[(Z)-prop-1-enyl]hex-4-en-3-imine.
| Compound Name | (Z)-1,2-difluoro-2-methyl-N-[(Z)-prop-1-enyl]hex-4-en-3-imine |
|---|---|
| PubChem CID | 143345041 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (Z)-1,2-difluoro-2-methyl-N-[(Z)-prop-1-enyl]hex-4-en-3-imine |
| SMILES | C/C=C\N=C(\C=C/C)C(C)(F)CF |
| InChI | InChI=1S/C10H15F2N/c1-4-6-9(13-7-5-2)10(3,12)8-11/h4-7H,8H2,1-3H3/b6-4-,7-5-,13-9- |
| InChIKey | ZJQHRCOMSNSRCZ-KDLBGYKSSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|