C12H13F — CID 143345877
2-ethyl-5-fluoro-7-prop-1-ynylcyclohepta-1,3,5-triene (PubChem CID 143345877) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is 2-ethyl-5-fluoro-7-prop-1-ynylcyclohepta-1,3,5-triene.
| Compound Name | 2-ethyl-5-fluoro-7-prop-1-ynylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143345877 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-ethyl-5-fluoro-7-prop-1-ynylcyclohepta-1,3,5-triene |
| SMILES | CC#CC1C=C(F)C=CC(CC)=C1 |
| InChI | InChI=1S/C12H13F/c1-3-5-11-8-10(4-2)6-7-12(13)9-11/h6-9,11H,4H2,1-2H3 |
| InChIKey | SFURQAIKZKAMOA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|