C12H16N2O — CID 143346288
(1R)-1-[4-(1-methoxyethenyl)phenyl]prop-2-ene-1,2-diamine (PubChem CID 143346288) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R)-1-[4-(1-methoxyethenyl)phenyl]prop-2-ene-1,2-diamine.
| Compound Name | (1R)-1-[4-(1-methoxyethenyl)phenyl]prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 143346288 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (1R)-1-[4-(1-methoxyethenyl)phenyl]prop-2-ene-1,2-diamine |
| SMILES | C=C(OC)c1ccc([C@@H](N)C(=C)N)cc1 |
| InChI | InChI=1S/C12H16N2O/c1-8(13)12(14)11-6-4-10(5-7-11)9(2)15-3/h4-7,12H,1-2,13-14H2,3H3/t12-/m0/s1 |
| InChIKey | CMEUNMYKDGFFPB-LBPRGKRZSA-N |
| XLogP | 1.78 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|