C11H17F2OP — CID 143346331
[[(1E,6Z)-3-ethylcycloocta-1,6-dien-1-yl]oxy-difluoromethyl]phosphane (PubChem CID 143346331) has the molecular formula C11H17F2OP and a molecular weight of 234.23 g/mol. Its IUPAC name is [[(1E,6Z)-3-ethylcycloocta-1,6-dien-1-yl]oxy-difluoromethyl]phosphane.
| Compound Name | [[(1E,6Z)-3-ethylcycloocta-1,6-dien-1-yl]oxy-difluoromethyl]phosphane |
|---|---|
| PubChem CID | 143346331 |
| Molecular Formula | C11H17F2OP |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | [[(1E,6Z)-3-ethylcycloocta-1,6-dien-1-yl]oxy-difluoromethyl]phosphane |
| SMILES | CCC1/C=C(/OC(F)(F)P)C/C=C\CC1 |
| InChI | InChI=1S/C11H17F2OP/c1-2-9-6-4-3-5-7-10(8-9)14-11(12,13)15/h3,5,8-9H,2,4,6-7,15H2,1H3/b5-3-,10-8+ |
| InChIKey | SUMCJHJNKRWAGJ-WEZLDLNLSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|