C11H17F3O — CID 144804758
(E)-5-ethenyl-2-(trifluoromethoxy)oct-2-ene (PubChem CID 144804758) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (E)-5-ethenyl-2-(trifluoromethoxy)oct-2-ene.
| Compound Name | (E)-5-ethenyl-2-(trifluoromethoxy)oct-2-ene |
|---|---|
| PubChem CID | 144804758 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (E)-5-ethenyl-2-(trifluoromethoxy)oct-2-ene |
| SMILES | C=CC(C/C=C(\C)OC(F)(F)F)CCC |
| InChI | InChI=1S/C11H17F3O/c1-4-6-10(5-2)8-7-9(3)15-11(12,13)14/h5,7,10H,2,4,6,8H2,1,3H3/b9-7+ |
| InChIKey | XYUWLGJXDDKPEY-VQHVLOKHSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|