C15H21F3O — CID 143346201
(1E,6Z)-2-methyl-6-(2-methylpropyl)-1-(trifluoromethoxy)cyclonona-1,3,6-triene (PubChem CID 143346201) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is (1E,6Z)-2-methyl-6-(2-methylpropyl)-1-(trifluoromethoxy)cyclonona-1,3,6-triene.
| Compound Name | (1E,6Z)-2-methyl-6-(2-methylpropyl)-1-(trifluoromethoxy)cyclonona-1,3,6-triene |
|---|---|
| PubChem CID | 143346201 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1E,6Z)-2-methyl-6-(2-methylpropyl)-1-(trifluoromethoxy)cyclonona-1,3,6-triene |
| SMILES | C/C1=C(\OC(F)(F)F)CC/C=C(/CC(C)C)CC=C1 |
| InChI | InChI=1S/C15H21F3O/c1-11(2)10-13-7-4-6-12(3)14(9-5-8-13)19-15(16,17)18/h4,6,8,11H,5,7,9-10H2,1-3H3/b6-4?,13-8+,14-12+ |
| InChIKey | CHLNQEDUILJUNN-BEORHGMBSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|