C12H20F2O — CID 143346376
(2E,5E)-3-(difluoromethoxy)-6,8-dimethylnona-2,5-diene (PubChem CID 143346376) has the molecular formula C12H20F2O and a molecular weight of 218.29 g/mol. Its IUPAC name is (2E,5E)-3-(difluoromethoxy)-6,8-dimethylnona-2,5-diene.
| Compound Name | (2E,5E)-3-(difluoromethoxy)-6,8-dimethylnona-2,5-diene |
|---|---|
| PubChem CID | 143346376 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (2E,5E)-3-(difluoromethoxy)-6,8-dimethylnona-2,5-diene |
| SMILES | C/C=C(\C/C=C(\C)CC(C)C)OC(F)F |
| InChI | InChI=1S/C12H20F2O/c1-5-11(15-12(13)14)7-6-10(4)8-9(2)3/h5-6,9,12H,7-8H2,1-4H3/b10-6+,11-5+ |
| InChIKey | KXEGMYASIJACDN-NVOKHFLUSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|