C11H17F3O — CID 123239565
8-methyl-2-(trifluoromethoxy)nona-1,5-diene (PubChem CID 123239565) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is 8-methyl-2-(trifluoromethoxy)nona-1,5-diene.
| Compound Name | 8-methyl-2-(trifluoromethoxy)nona-1,5-diene |
|---|---|
| PubChem CID | 123239565 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 8-methyl-2-(trifluoromethoxy)nona-1,5-diene |
| SMILES | C=C(CCC=CCC(C)C)OC(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-9(2)7-5-4-6-8-10(3)15-11(12,13)14/h4-5,9H,3,6-8H2,1-2H3 |
| InChIKey | WRNCLKVEAWCUFH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|