C29H26N8O5 — CID 143346351
5-N-(2,1,3-benzoxadiazol-5-ylmethyl)-7-N-[(1S)-4-methyl-5-(2-prop-2-enoxyacetyl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143346351) has the molecular formula C29H26N8O5 and a molecular weight of 566.58 g/mol. Its IUPAC name is 5-N-(2,1,3-benzoxadiazol-5-ylmethyl)-7-N-[(1S)-4-methyl-5-(2-prop-2-enoxyacetyl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 5-N-(2,1,3-benzoxadiazol-5-ylmethyl)-7-N-[(1S)-4-methyl-5-(2-prop-2-enoxyacetyl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143346351 |
| Molecular Formula | C29H26N8O5 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 5-N-(2,1,3-benzoxadiazol-5-ylmethyl)-7-N-[(1S)-4-methyl-5-(2-prop-2-enoxyacetyl)-2,3-dihydro-1H-inden-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | C=CCOCC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc3nonc3c2)nc2ncnn12 |
| InChI | InChI=1S/C29H26N8O5/c1-3-10-41-14-26(38)19-5-6-20-18(16(19)2)7-9-21(20)33-28(40)25-12-24(34-29-31-15-32-37(25)29)27(39)30-13-17-4-8-22-23(11-17)36-42-35-22/h3-6,8,11-12,15,21H,1,7,9-10,13-14H2,2H3,(H,30,39)(H,33,40)/t21-/m0/s1 |
| InChIKey | CVNCROJHHXJXAV-NRFANRHFSA-N |
| XLogP | 2.70 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|