C13H19NS — CID 143347497
N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)methanethioamide (PubChem CID 143347497) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)methanethioamide.
| Compound Name | N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)methanethioamide |
|---|---|
| PubChem CID | 143347497 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)methanethioamide |
| SMILES | CCCC1=CC=CC(C)(C)C=C1NC=S |
| InChI | InChI=1S/C13H19NS/c1-4-6-11-7-5-8-13(2,3)9-12(11)14-10-15/h5,7-10H,4,6H2,1-3H3,(H,14,15) |
| InChIKey | YOAWOBANFCQNOG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|