C21H28ClNO — CID 143349367
2-amino-4-[2-chloro-4-(4-phenylbutyl)phenyl]-2-methylbutan-1-ol (PubChem CID 143349367) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is 2-amino-4-[2-chloro-4-(4-phenylbutyl)phenyl]-2-methylbutan-1-ol.
| Compound Name | 2-amino-4-[2-chloro-4-(4-phenylbutyl)phenyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 143349367 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-amino-4-[2-chloro-4-(4-phenylbutyl)phenyl]-2-methylbutan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(CCCCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H28ClNO/c1-21(23,16-24)14-13-19-12-11-18(15-20(19)22)10-6-5-9-17-7-3-2-4-8-17/h2-4,7-8,11-12,15,24H,5-6,9-10,13-14,16,23H2,1H3 |
| InChIKey | RSCMOQSDPVJRMM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|