C25H44BrNO6 — CID 143349449
2-[5-(4-bromophenyl)pentoxy]oxane;N-(methoxymethoxymethyl)formamide;2-methoxy-2-methylpropane (PubChem CID 143349449) has the molecular formula C25H44BrNO6 and a molecular weight of 534.53 g/mol. Its IUPAC name is 2-[5-(4-bromophenyl)pentoxy]oxane;N-(methoxymethoxymethyl)formamide;2-methoxy-2-methylpropane.
| Compound Name | 2-[5-(4-bromophenyl)pentoxy]oxane;N-(methoxymethoxymethyl)formamide;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 143349449 |
| Molecular Formula | C25H44BrNO6 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-[5-(4-bromophenyl)pentoxy]oxane;N-(methoxymethoxymethyl)formamide;2-methoxy-2-methylpropane |
| SMILES | Brc1ccc(CCCCCOC2CCCCO2)cc1.COC(C)(C)C.COCOCNC=O |
| InChI | InChI=1S/C16H23BrO2.C5H12O.C4H9NO3/c17-15-10-8-14(9-11-15)6-2-1-4-12-18-16-7-3-5-13-19-16;1-5(2,3)6-4;1-7-4-8-3-5-2-6/h8-11,16H,1-7,12-13H2;1-4H3;2H,3-4H2,1H3,(H,5,6) |
| InChIKey | JSHDHGAZFHVZGL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|