C32H49BrO4Si — CID 159295209
2-[2-(4-bromophenyl)ethoxy]oxane;[4-[2-(oxan-2-yloxy)ethyl]phenyl]-di(propan-2-yl)silane (PubChem CID 159295209) has the molecular formula C32H49BrO4Si and a molecular weight of 605.73 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)ethoxy]oxane;[4-[2-(oxan-2-yloxy)ethyl]phenyl]-di(propan-2-yl)silane.
| Compound Name | 2-[2-(4-bromophenyl)ethoxy]oxane;[4-[2-(oxan-2-yloxy)ethyl]phenyl]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 159295209 |
| Molecular Formula | C32H49BrO4Si |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 2-[2-(4-bromophenyl)ethoxy]oxane;[4-[2-(oxan-2-yloxy)ethyl]phenyl]-di(propan-2-yl)silane |
| SMILES | Brc1ccc(CCOC2CCCCO2)cc1.CC(C)[SiH](c1ccc(CCOC2CCCCO2)cc1)C(C)C |
| InChI | InChI=1S/C19H32O2Si.C13H17BrO2/c1-15(2)22(16(3)4)18-10-8-17(9-11-18)12-14-21-19-7-5-6-13-20-19;14-12-6-4-11(5-7-12)8-10-16-13-3-1-2-9-15-13/h8-11,15-16,19,22H,5-7,12-14H2,1-4H3;4-7,13H,1-3,8-10H2 |
| InChIKey | LAPZHXTUFWGFHB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|