C23H32N4O2 — CID 143349905
ethane;3-[3-[2-[ethyl(propyl)amino]ethoxy]phenyl]-1H-indazole-5-carboxamide (PubChem CID 143349905) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is ethane;3-[3-[2-[ethyl(propyl)amino]ethoxy]phenyl]-1H-indazole-5-carboxamide.
| Compound Name | ethane;3-[3-[2-[ethyl(propyl)amino]ethoxy]phenyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 143349905 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | ethane;3-[3-[2-[ethyl(propyl)amino]ethoxy]phenyl]-1H-indazole-5-carboxamide |
| SMILES | CC.CCCN(CC)CCOc1cccc(-c2n[nH]c3ccc(C(N)=O)cc23)c1 |
| InChI | InChI=1S/C21H26N4O2.C2H6/c1-3-10-25(4-2)11-12-27-17-7-5-6-15(13-17)20-18-14-16(21(22)26)8-9-19(18)23-24-20;1-2/h5-9,13-14H,3-4,10-12H2,1-2H3,(H2,22,26)(H,23,24);1-2H3 |
| InChIKey | AQRQOYCUNJXZML-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |