C18H30N4O3 — CID 143351782
1-(2-amino-2-cyclohexylacetyl)-N-(3-carbamoylbut-3-en-2-yl)pyrrolidine-2-carboxamide (PubChem CID 143351782) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-(2-amino-2-cyclohexylacetyl)-N-(3-carbamoylbut-3-en-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-2-cyclohexylacetyl)-N-(3-carbamoylbut-3-en-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143351782 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 1-(2-amino-2-cyclohexylacetyl)-N-(3-carbamoylbut-3-en-2-yl)pyrrolidine-2-carboxamide |
| SMILES | C=C(C(N)=O)C(C)NC(=O)C1CCCN1C(=O)C(N)C1CCCCC1 |
| InChI | InChI=1S/C18H30N4O3/c1-11(16(20)23)12(2)21-17(24)14-9-6-10-22(14)18(25)15(19)13-7-4-3-5-8-13/h12-15H,1,3-10,19H2,2H3,(H2,20,23)(H,21,24) |
| InChIKey | INUAVJPKMMKRDP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|