About [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide
[(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide (PubChem CID 143352483) has the molecular formula C16H25I
and a molecular weight of 344.28 g/mol. Its IUPAC name is [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide.
Molecular Properties
| Compound Name | [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide |
| PubChem CID | 143352483 |
| Molecular Formula | C16H25I |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide |
| SMILES | C#CC(C)[C@@H](CC)c1ccccc1.CCC.I |
| InChI | InChI=1S/C13H16.C3H8.HI/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;1-3-2;/h1,6-11,13H,5H2,2-3H3;3H2,1-2H3;1H/t11?,13-;;/m1../s1 |
| InChIKey | ITKDFNDDAXFVEJ-RNVQNLIPSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide?
The IUPAC name of [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide (CID 143352483) is [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide.
What is the SMILES notation for [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide?
The canonical SMILES for [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide is C#CC(C)[C@@H](CC)c1ccccc1.CCC.I.
What is the InChIKey of [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide?
The InChIKey is ITKDFNDDAXFVEJ-RNVQNLIPSA-N. The full InChI is InChI=1S/C13H16.C3H8.HI/c1-4-11(3)13(5-2)12-9-7-6-8-10-12;1-3-2;/h1,6-11,13H,5H2,2-3H3;3H2,1-2H3;1H/t11?,13-;;/m1../s1.
What are the key properties of [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide?
[(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide has a molecular weight of 344.28 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4-methylhex-5-yn-3-yl]benzene;propane;hydroiodide is sourced from PubChem (CID 143352483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).