C24H37NO4 — CID 143355408
(E,4R)-1-[(2S,3R)-1-[(2S)-2-cyclohexylpropanoyl]-3-methylpyrrolidin-2-yl]-4-propylhept-2-ene-1,5,6-trione (PubChem CID 143355408) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is (E,4R)-1-[(2S,3R)-1-[(2S)-2-cyclohexylpropanoyl]-3-methylpyrrolidin-2-yl]-4-propylhept-2-ene-1,5,6-trione.
| Compound Name | (E,4R)-1-[(2S,3R)-1-[(2S)-2-cyclohexylpropanoyl]-3-methylpyrrolidin-2-yl]-4-propylhept-2-ene-1,5,6-trione |
|---|---|
| PubChem CID | 143355408 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (E,4R)-1-[(2S,3R)-1-[(2S)-2-cyclohexylpropanoyl]-3-methylpyrrolidin-2-yl]-4-propylhept-2-ene-1,5,6-trione |
| SMILES | CCC[C@H](/C=C/C(=O)[C@@H]1[C@H](C)CCN1C(=O)[C@@H](C)C1CCCCC1)C(=O)C(C)=O |
| InChI | InChI=1S/C24H37NO4/c1-5-9-20(23(28)18(4)26)12-13-21(27)22-16(2)14-15-25(22)24(29)17(3)19-10-7-6-8-11-19/h12-13,16-17,19-20,22H,5-11,14-15H2,1-4H3/b13-12+/t16-,17+,20-,22+/m1/s1 |
| InChIKey | NXDSZILQEJNBOV-XSMAIVMPSA-N |
| XLogP | 4.14 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|