C27H48N4O6 — CID 143356620
(2R)-2-[[[(2S)-1-[2-[[(2S)-1-cyclopropyl-3-methyl-1-oxobutan-2-yl]carbamoylamino]acetyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-ethylnonanoic acid (PubChem CID 143356620) has the molecular formula C27H48N4O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is (2R)-2-[[[(2S)-1-[2-[[(2S)-1-cyclopropyl-3-methyl-1-oxobutan-2-yl]carbamoylamino]acetyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-ethylnonanoic acid.
| Compound Name | (2R)-2-[[[(2S)-1-[2-[[(2S)-1-cyclopropyl-3-methyl-1-oxobutan-2-yl]carbamoylamino]acetyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-ethylnonanoic acid |
|---|---|
| PubChem CID | 143356620 |
| Molecular Formula | C27H48N4O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | (2R)-2-[[[(2S)-1-[2-[[(2S)-1-cyclopropyl-3-methyl-1-oxobutan-2-yl]carbamoylamino]acetyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-ethylnonanoic acid |
| SMILES | CCCCCCC[C@@](CC)(NC(O)[C@@H]1CCCN1C(=O)CNC(=O)N[C@H](C(=O)C1CC1)C(C)C)C(=O)O |
| InChI | InChI=1S/C27H48N4O6/c1-5-7-8-9-10-15-27(6-2,25(35)36)30-24(34)20-12-11-16-31(20)21(32)17-28-26(37)29-22(18(3)4)23(33)19-13-14-19/h18-20,22,24,30,34H,5-17H2,1-4H3,(H,35,36)(H2,28,29,37)/t20-,22-,24?,27+/m0/s1 |
| InChIKey | QWBKVRXRAVJUFB-UXOMFQOJSA-N |
| XLogP | 2.78 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|