C16H29N3O3S — CID 143382233
2-(hex-1-en-2-ylamino)-1-[2-[hydroxy-[[(Z)-2-hydroxy-3-sulfanylprop-2-enyl]amino]methyl]pyrrolidin-1-yl]ethanone (PubChem CID 143382233) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-(hex-1-en-2-ylamino)-1-[2-[hydroxy-[[(Z)-2-hydroxy-3-sulfanylprop-2-enyl]amino]methyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(hex-1-en-2-ylamino)-1-[2-[hydroxy-[[(Z)-2-hydroxy-3-sulfanylprop-2-enyl]amino]methyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 143382233 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(hex-1-en-2-ylamino)-1-[2-[hydroxy-[[(Z)-2-hydroxy-3-sulfanylprop-2-enyl]amino]methyl]pyrrolidin-1-yl]ethanone |
| SMILES | C=C(CCCC)NCC(=O)N1CCCC1C(O)NC/C(O)=C/S |
| InChI | InChI=1S/C16H29N3O3S/c1-3-4-6-12(2)17-10-15(21)19-8-5-7-14(19)16(22)18-9-13(20)11-23/h11,14,16-18,20,22-23H,2-10H2,1H3/b13-11- |
| InChIKey | LSJWAXOJWATKMR-QBFSEMIESA-N |
| XLogP | 1.51 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|