C24H45N3O3 — CID 163501920
2-(cyclopentyloxymethylamino)-1-[(2S)-2-[[[(1R,2R)-2-heptyl-1-methylcyclopropyl]amino]-hydroxymethyl]pyrrolidin-1-yl]ethanone (PubChem CID 163501920) has the molecular formula C24H45N3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is 2-(cyclopentyloxymethylamino)-1-[(2S)-2-[[[(1R,2R)-2-heptyl-1-methylcyclopropyl]amino]-hydroxymethyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(cyclopentyloxymethylamino)-1-[(2S)-2-[[[(1R,2R)-2-heptyl-1-methylcyclopropyl]amino]-hydroxymethyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 163501920 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | 2-(cyclopentyloxymethylamino)-1-[(2S)-2-[[[(1R,2R)-2-heptyl-1-methylcyclopropyl]amino]-hydroxymethyl]pyrrolidin-1-yl]ethanone |
| SMILES | CCCCCCC[C@@H]1C[C@@]1(C)NC(O)[C@@H]1CCCN1C(=O)CNCOC1CCCC1 |
| InChI | InChI=1S/C24H45N3O3/c1-3-4-5-6-7-11-19-16-24(19,2)26-23(29)21-14-10-15-27(21)22(28)17-25-18-30-20-12-8-9-13-20/h19-21,23,25-26,29H,3-18H2,1-2H3/t19-,21+,23?,24-/m1/s1 |
| InChIKey | AEZNLMOBTSPEDP-FDTPFYMFSA-N |
| XLogP | 3.53 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|