C41H64N4O2S — CID 143668524
7-[8-[[2-[2-[(4S)-2-(cyclopropylsulfanylamino)-4-methylundec-1-en-3-yl]pyrrolidin-1-yl]-2-oxoethyl]amino]non-8-enyl]-6-ethyl-2H-isoquinolin-1-one (PubChem CID 143668524) has the molecular formula C41H64N4O2S and a molecular weight of 677.06 g/mol. Its IUPAC name is 7-[8-[[2-[2-[(4S)-2-(cyclopropylsulfanylamino)-4-methylundec-1-en-3-yl]pyrrolidin-1-yl]-2-oxoethyl]amino]non-8-enyl]-6-ethyl-2H-isoquinolin-1-one.
| Compound Name | 7-[8-[[2-[2-[(4S)-2-(cyclopropylsulfanylamino)-4-methylundec-1-en-3-yl]pyrrolidin-1-yl]-2-oxoethyl]amino]non-8-enyl]-6-ethyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 143668524 |
| Molecular Formula | C41H64N4O2S |
| Molecular Weight | 677.06 g/mol |
| Exact Mass | 676.47 |
| IUPAC Name | 7-[8-[[2-[2-[(4S)-2-(cyclopropylsulfanylamino)-4-methylundec-1-en-3-yl]pyrrolidin-1-yl]-2-oxoethyl]amino]non-8-enyl]-6-ethyl-2H-isoquinolin-1-one |
| SMILES | C=C(CCCCCCCc1cc2c(=O)[nH]ccc2cc1CC)NCC(=O)N1CCCC1C(C(=C)NSC1CC1)[C@@H](C)CCCCCCC |
| InChI | InChI=1S/C41H64N4O2S/c1-6-8-9-11-14-18-30(3)40(32(5)44-48-36-22-23-36)38-21-17-26-45(38)39(46)29-43-31(4)19-15-12-10-13-16-20-34-28-37-35(27-33(34)7-2)24-25-42-41(37)47/h24-25,27-28,30,36,38,40,43-44H,4-23,26,29H2,1-3H3,(H,42,47)/t30-,38?,40?/m0/s1 |
| InChIKey | MIDWAYCPJNVPPD-QWLZEQIMSA-N |
| XLogP | 9.59 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.06 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|