C27H49N5O6S — CID 143356786
(2S)-1-[(2S)-2-[[(2S)-1-[butyl(hydroxysulfanyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(3,4-dioxopentan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 143356786) has the molecular formula C27H49N5O6S and a molecular weight of 571.79 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-1-[butyl(hydroxysulfanyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(3,4-dioxopentan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-1-[butyl(hydroxysulfanyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(3,4-dioxopentan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143356786 |
| Molecular Formula | C27H49N5O6S |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-1-[butyl(hydroxysulfanyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(3,4-dioxopentan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCCN(C[C@@H](NC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NC(C)C(=O)C(C)=O)C(C)(C)C)C(C)(C)C)SO |
| InChI | InChI=1S/C27H49N5O6S/c1-10-11-14-31(39-38)16-20(26(4,5)6)29-25(37)30-22(27(7,8)9)24(36)32-15-12-13-19(32)23(35)28-17(2)21(34)18(3)33/h17,19-20,22,38H,10-16H2,1-9H3,(H,28,35)(H2,29,30,37)/t17?,19-,20+,22+/m0/s1 |
| InChIKey | WGOUTGBCVMWPPX-GTOYWCMISA-N |
| XLogP | 2.99 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|