C22H35F2N5O5 — CID 143357878
(2S,3S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3,4-dimethylpyrrolidine-2-carboxamide (PubChem CID 143357878) has the molecular formula C22H35F2N5O5 and a molecular weight of 487.55 g/mol. Its IUPAC name is (2S,3S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3,4-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3,4-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143357878 |
| Molecular Formula | C22H35F2N5O5 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (2S,3S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3,4-dimethylpyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)[C@H](CC(F)F)NC(=O)[C@@H]1[C@@H](C)[C@@H](C)CN1C(=O)[C@@H](NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C22H35F2N5O5/c1-7-8-26-19(32)16(30)13(9-14(23)24)27-18(31)15-12(3)11(2)10-29(15)20(33)17(22(4,5)6)28-21(25)34/h7,11-15,17H,1,8-10H2,2-6H3,(H,26,32)(H,27,31)(H3,25,28,34)/t11-,12-,13-,15-,17+/m0/s1 |
| InChIKey | FRNPUHXSLXWJQH-VERFIZQUSA-N |
| XLogP | 0.56 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|