C23H38F2N6O5 — CID 143362108
(2S,3S,4R)-4-amino-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3-propylpyrrolidine-2-carboxamide (PubChem CID 143362108) has the molecular formula C23H38F2N6O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is (2S,3S,4R)-4-amino-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3S,4R)-4-amino-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143362108 |
| Molecular Formula | C23H38F2N6O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (2S,3S,4R)-4-amino-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-3-propylpyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)[C@H](CC(F)F)NC(=O)[C@@H]1[C@@H](CCC)[C@@H](N)CN1C(=O)[C@@H](NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C23H38F2N6O5/c1-6-8-12-13(26)11-31(21(35)18(23(3,4)5)30-22(27)36)16(12)19(33)29-14(10-15(24)25)17(32)20(34)28-9-7-2/h7,12-16,18H,2,6,8-11,26H2,1,3-5H3,(H,28,34)(H,29,33)(H3,27,30,36)/t12-,13-,14-,16-,18+/m0/s1 |
| InChIKey | PLPPNRHUHNHVHM-KBXBGSNASA-N |
| XLogP | 0.04 |
| TPSA | 176.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|