C46H80N2 — CID 143358126
5-cyclopropyl-4-methyl-3-methylidenepent-1-en-2-amine;6-(3-ethyl-2,2-dimethylcyclopropyl)-2,2,5-trimethyl-4,7-dimethylidene-N-prop-1-en-2-ylnon-8-en-3-amine;4-methylidenehexylcyclopentane (PubChem CID 143358126) has the molecular formula C46H80N2 and a molecular weight of 661.16 g/mol. Its IUPAC name is 5-cyclopropyl-4-methyl-3-methylidenepent-1-en-2-amine;6-(3-ethyl-2,2-dimethylcyclopropyl)-2,2,5-trimethyl-4,7-dimethylidene-N-prop-1-en-2-ylnon-8-en-3-amine;4-methylidenehexylcyclopentane.
| Compound Name | 5-cyclopropyl-4-methyl-3-methylidenepent-1-en-2-amine;6-(3-ethyl-2,2-dimethylcyclopropyl)-2,2,5-trimethyl-4,7-dimethylidene-N-prop-1-en-2-ylnon-8-en-3-amine;4-methylidenehexylcyclopentane |
|---|---|
| PubChem CID | 143358126 |
| Molecular Formula | C46H80N2 |
| Molecular Weight | 661.16 g/mol |
| Exact Mass | 660.63 |
| IUPAC Name | 5-cyclopropyl-4-methyl-3-methylidenepent-1-en-2-amine;6-(3-ethyl-2,2-dimethylcyclopropyl)-2,2,5-trimethyl-4,7-dimethylidene-N-prop-1-en-2-ylnon-8-en-3-amine;4-methylidenehexylcyclopentane |
| SMILES | C=C(CC)CCCC1CCCC1.C=C(N)C(=C)C(C)CC1CC1.C=CC(=C)C(C(C)C(=C)C(NC(=C)C)C(C)(C)C)C1C(CC)C1(C)C |
| InChI | InChI=1S/C24H41N.C12H22.C10H17N/c1-13-16(5)20(21-19(14-2)24(21,11)12)17(6)18(7)22(23(8,9)10)25-15(3)4;1-3-11(2)7-6-10-12-8-4-5-9-12;1-7(6-10-4-5-10)8(2)9(3)11/h13,17,19-22,25H,1,3,5,7,14H2,2,4,6,8-12H3;12H,2-10H2,1H3;7,10H,2-6,11H2,1H3 |
| InChIKey | DIGOOBCGFWZQLQ-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.16 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|