C9H15N — CID 143359820
(6-methylcyclohepta-2,4-dien-1-yl)methanamine (PubChem CID 143359820) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (6-methylcyclohepta-2,4-dien-1-yl)methanamine.
| Compound Name | (6-methylcyclohepta-2,4-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 143359820 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (6-methylcyclohepta-2,4-dien-1-yl)methanamine |
| SMILES | CC1C=CC=CC(CN)C1 |
| InChI | InChI=1S/C9H15N/c1-8-4-2-3-5-9(6-8)7-10/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | SEMQBPNNYDCSBX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |