About azane;3-ethyl-2-methyloxetane;dihydrate
azane;3-ethyl-2-methyloxetane;dihydrate (PubChem CID 143363740) has the molecular formula C6H19NO3
and a molecular weight of 153.22 g/mol. Its IUPAC name is azane;3-ethyl-2-methyloxetane;dihydrate.
Molecular Properties
| Compound Name | azane;3-ethyl-2-methyloxetane;dihydrate |
| PubChem CID | 143363740 |
| Molecular Formula | C6H19NO3 |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | azane;3-ethyl-2-methyloxetane;dihydrate |
| SMILES | CCC1COC1C.N.O.O |
| InChI | InChI=1S/C6H12O.H3N.2H2O/c1-3-6-4-7-5(6)2;;;/h5-6H,3-4H2,1-2H3;1H3;2*1H2 |
| InChIKey | YIJZRDBZOALXCN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;3-ethyl-2-methyloxetane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-ethyl-2-methyloxetane;dihydrate?
The IUPAC name of azane;3-ethyl-2-methyloxetane;dihydrate (CID 143363740) is azane;3-ethyl-2-methyloxetane;dihydrate.
What is the SMILES notation for azane;3-ethyl-2-methyloxetane;dihydrate?
The canonical SMILES for azane;3-ethyl-2-methyloxetane;dihydrate is CCC1COC1C.N.O.O.
What is the InChIKey of azane;3-ethyl-2-methyloxetane;dihydrate?
The InChIKey is YIJZRDBZOALXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.H3N.2H2O/c1-3-6-4-7-5(6)2;;;/h5-6H,3-4H2,1-2H3;1H3;2*1H2.
What are the key properties of azane;3-ethyl-2-methyloxetane;dihydrate?
azane;3-ethyl-2-methyloxetane;dihydrate has a molecular weight of 153.22 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-ethyl-2-methyloxetane;dihydrate is sourced from PubChem (CID 143363740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).