C9H18O — CID 163593712
(5S)-4-ethyl-2,5-dimethyloxane (PubChem CID 163593712) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (5S)-4-ethyl-2,5-dimethyloxane.
| Compound Name | (5S)-4-ethyl-2,5-dimethyloxane |
|---|---|
| PubChem CID | 163593712 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (5S)-4-ethyl-2,5-dimethyloxane |
| SMILES | CCC1CC(C)OC[C@H]1C |
| InChI | InChI=1S/C9H18O/c1-4-9-5-8(3)10-6-7(9)2/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m1/s1 |
| InChIKey | GRRDSEGWXUQRPV-AFPNSQJFSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |