C14H13N5 — CID 143363755
N-[(methylideneamino)methyl]-2-phenylimidazo[1,2-a]pyrazin-3-amine (PubChem CID 143363755) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(methylideneamino)methyl]-2-phenylimidazo[1,2-a]pyrazin-3-amine.
| Compound Name | N-[(methylideneamino)methyl]-2-phenylimidazo[1,2-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 143363755 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(methylideneamino)methyl]-2-phenylimidazo[1,2-a]pyrazin-3-amine |
| SMILES | C=NCNc1c(-c2ccccc2)nc2cnccn12 |
| InChI | InChI=1S/C14H13N5/c1-15-10-17-14-13(11-5-3-2-4-6-11)18-12-9-16-7-8-19(12)14/h2-9,17H,1,10H2 |
| InChIKey | QJROXEVCNNZRPH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|