C21H36N2O2 — CID 143364801
ethane;N-[(2E)-4-[(3Z)-penta-1,3-dien-2-yl]oxypenta-2,4-dien-2-yl]-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 143364801) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is ethane;N-[(2E)-4-[(3Z)-penta-1,3-dien-2-yl]oxypenta-2,4-dien-2-yl]-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | ethane;N-[(2E)-4-[(3Z)-penta-1,3-dien-2-yl]oxypenta-2,4-dien-2-yl]-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 143364801 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | ethane;N-[(2E)-4-[(3Z)-penta-1,3-dien-2-yl]oxypenta-2,4-dien-2-yl]-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | C=C(/C=C\C)OC(=C)/C=C(\C)N(CCN1CCCCC1)C(C)=O.CC |
| InChI | InChI=1S/C19H30N2O2.C2H6/c1-6-10-17(3)23-18(4)15-16(2)21(19(5)22)14-13-20-11-8-7-9-12-20;1-2/h6,10,15H,3-4,7-9,11-14H2,1-2,5H3;1-2H3/b10-6-,16-15+; |
| InChIKey | NYUKNPVKIYHGBP-XPMVKVLASA-N |
| XLogP | 4.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|