C13H20N2O2 — CID 123284533
1-[4-(5-methoxyhexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone (PubChem CID 123284533) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[4-(5-methoxyhexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(5-methoxyhexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 123284533 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[4-(5-methoxyhexa-1,3,5-trien-3-yl)piperazin-1-yl]ethanone |
| SMILES | C=CC(=CC(=C)OC)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H20N2O2/c1-5-13(10-11(2)17-4)15-8-6-14(7-9-15)12(3)16/h5,10H,1-2,6-9H2,3-4H3 |
| InChIKey | DVDHWAMXHMPXGJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|