C12H20FNO2 — CID 171647225
ethane;N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide (PubChem CID 171647225) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is ethane;N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide.
| Compound Name | ethane;N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 171647225 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethane;N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide |
| SMILES | C=C/C(=C\C(=C)OCF)N(C)C(C)=O.CC |
| InChI | InChI=1S/C10H14FNO2.C2H6/c1-5-10(12(4)9(3)13)6-8(2)14-7-11;1-2/h5-6H,1-2,7H2,3-4H3;1-2H3/b10-6+; |
| InChIKey | MAOZLSHLQONJFP-AAGWESIMSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|