C10H14FNO2 — CID 171647226
N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide (PubChem CID 171647226) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide.
| Compound Name | N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 171647226 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-[(3E)-5-(fluoromethoxy)hexa-1,3,5-trien-3-yl]-N-methylacetamide |
| SMILES | C=C/C(=C\C(=C)OCF)N(C)C(C)=O |
| InChI | InChI=1S/C10H14FNO2/c1-5-10(12(4)9(3)13)6-8(2)14-7-11/h5-6H,1-2,7H2,3-4H3/b10-6+ |
| InChIKey | YYICSKGDZLFVSD-UXBLZVDNSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|