C21H37F — CID 143365227
2-fluoroprop-1-ene;6-hexyl-2-methyl-6-prop-2-enyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 143365227) has the molecular formula C21H37F and a molecular weight of 308.53 g/mol. Its IUPAC name is 2-fluoroprop-1-ene;6-hexyl-2-methyl-6-prop-2-enyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | 2-fluoroprop-1-ene;6-hexyl-2-methyl-6-prop-2-enyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 143365227 |
| Molecular Formula | C21H37F |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 2-fluoroprop-1-ene;6-hexyl-2-methyl-6-prop-2-enyl-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | C=C(C)F.C=CCC1(CCCCCC)CCC2CC(C)CC21 |
| InChI | InChI=1S/C18H32.C3H5F/c1-4-6-7-8-11-18(10-5-2)12-9-16-13-15(3)14-17(16)18;1-3(2)4/h5,15-17H,2,4,6-14H2,1,3H3;1H2,2H3 |
| InChIKey | OGAREIDMZHVPCF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|