C21H25FO2 — CID 143366107
2-[2-fluoro-4-[2-methyl-4-(3-methylpentan-3-yl)phenyl]phenyl]acetic acid (PubChem CID 143366107) has the molecular formula C21H25FO2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-methyl-4-(3-methylpentan-3-yl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[2-methyl-4-(3-methylpentan-3-yl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 143366107 |
| Molecular Formula | C21H25FO2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[2-fluoro-4-[2-methyl-4-(3-methylpentan-3-yl)phenyl]phenyl]acetic acid |
| SMILES | CCC(C)(CC)c1ccc(-c2ccc(CC(=O)O)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C21H25FO2/c1-5-21(4,6-2)17-9-10-18(14(3)11-17)15-7-8-16(13-20(23)24)19(22)12-15/h7-12H,5-6,13H2,1-4H3,(H,23,24) |
| InChIKey | GDDHKAQNYDJKIG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |