C9H13NO — CID 143367781
(4-methoxycyclohepta-1,3,6-trien-1-yl)methanamine (PubChem CID 143367781) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4-methoxycyclohepta-1,3,6-trien-1-yl)methanamine.
| Compound Name | (4-methoxycyclohepta-1,3,6-trien-1-yl)methanamine |
|---|---|
| PubChem CID | 143367781 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4-methoxycyclohepta-1,3,6-trien-1-yl)methanamine |
| SMILES | COC1=CC=C(CN)C=CC1 |
| InChI | InChI=1S/C9H13NO/c1-11-9-4-2-3-8(7-10)5-6-9/h2-3,5-6H,4,7,10H2,1H3 |
| InChIKey | VPNRMPNVHYJAHS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |