C23H28IN3O3 — CID 143370722
ethane;3-ethyl-4-(2-hydroxyethyl)-N-(4-iodophenyl)-1-(4-methoxyphenyl)pyrazole-5-carboxamide (PubChem CID 143370722) has the molecular formula C23H28IN3O3 and a molecular weight of 521.40 g/mol. Its IUPAC name is ethane;3-ethyl-4-(2-hydroxyethyl)-N-(4-iodophenyl)-1-(4-methoxyphenyl)pyrazole-5-carboxamide.
| Compound Name | ethane;3-ethyl-4-(2-hydroxyethyl)-N-(4-iodophenyl)-1-(4-methoxyphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 143370722 |
| Molecular Formula | C23H28IN3O3 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | ethane;3-ethyl-4-(2-hydroxyethyl)-N-(4-iodophenyl)-1-(4-methoxyphenyl)pyrazole-5-carboxamide |
| SMILES | CC.CCc1nn(-c2ccc(OC)cc2)c(C(=O)Nc2ccc(I)cc2)c1CCO |
| InChI | InChI=1S/C21H22IN3O3.C2H6/c1-3-19-18(12-13-26)20(21(27)23-15-6-4-14(22)5-7-15)25(24-19)16-8-10-17(28-2)11-9-16;1-2/h4-11,26H,3,12-13H2,1-2H3,(H,23,27);1-2H3 |
| InChIKey | ZNCKOWNDABHXPA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|