C19H19ClN4O2 — CID 35281421
1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-3-(4-methoxyphenyl)urea (PubChem CID 35281421) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 35281421 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(-n3nc(C)c(Cl)c3C)cc2)cc1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12-18(20)13(2)24(23-12)16-8-4-14(5-9-16)21-19(25)22-15-6-10-17(26-3)11-7-15/h4-11H,1-3H3,(H2,21,22,25) |
| InChIKey | XRIKKCPQPAZORI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |