C21H26N4O2Si — CID 11153624
1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea (PubChem CID 11153624) has the molecular formula C21H26N4O2Si and a molecular weight of 394.55 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 11153624 |
| Molecular Formula | C21H26N4O2Si |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cc([Si](C)(C)C)nn2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O2Si/c1-15-6-10-17(11-7-15)25-19(14-20(24-25)28(3,4)5)23-21(26)22-16-8-12-18(27-2)13-9-16/h6-14H,1-5H3,(H2,22,23,26) |
| InChIKey | GPYNSROVRMXHIH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|