C20H25N5O3S — CID 143370841
methoxy-[6-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-2,5-dihydro-1H-azepin-2-yl]methanol (PubChem CID 143370841) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is methoxy-[6-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-2,5-dihydro-1H-azepin-2-yl]methanol.
| Compound Name | methoxy-[6-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-2,5-dihydro-1H-azepin-2-yl]methanol |
|---|---|
| PubChem CID | 143370841 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | methoxy-[6-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]-2,5-dihydro-1H-azepin-2-yl]methanol |
| SMILES | COC(O)C1C=CCC(c2cnc(Nc3cc(N4CCOCC4)ccn3)s2)=CN1 |
| InChI | InChI=1S/C20H25N5O3S/c1-27-19(26)16-4-2-3-14(12-22-16)17-13-23-20(29-17)24-18-11-15(5-6-21-18)25-7-9-28-10-8-25/h2,4-6,11-13,16,19,22,26H,3,7-10H2,1H3,(H,21,23,24) |
| InChIKey | WLONHMSJWCXBFW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|