C17H22FIN4O2 — CID 143371302
tert-butyl N-[1-[6-[(E)-2-fluoroethenyl]-5-[(Z)-2-iodoethenyl]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 143371302) has the molecular formula C17H22FIN4O2 and a molecular weight of 460.29 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[(E)-2-fluoroethenyl]-5-[(Z)-2-iodoethenyl]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[(E)-2-fluoroethenyl]-5-[(Z)-2-iodoethenyl]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 143371302 |
| Molecular Formula | C17H22FIN4O2 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | tert-butyl N-[1-[6-[(E)-2-fluoroethenyl]-5-[(Z)-2-iodoethenyl]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ncnc(/C=C/F)c2/C=C\I)C1 |
| InChI | InChI=1S/C17H22FIN4O2/c1-17(2,3)25-16(24)22-12-6-9-23(10-12)15-13(5-8-19)14(4-7-18)20-11-21-15/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H,22,24)/b7-4+,8-5- |
| InChIKey | IWTLTQVMWSZYLE-NIQPXEJBSA-N |
| XLogP | 3.93 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|