C21H18F2N2O2 — CID 143372345
difluoromethane;3-[hydroxy-(1-phenylindazol-5-yl)methyl]phenol (PubChem CID 143372345) has the molecular formula C21H18F2N2O2 and a molecular weight of 368.38 g/mol. Its IUPAC name is difluoromethane;3-[hydroxy-(1-phenylindazol-5-yl)methyl]phenol.
| Compound Name | difluoromethane;3-[hydroxy-(1-phenylindazol-5-yl)methyl]phenol |
|---|---|
| PubChem CID | 143372345 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | difluoromethane;3-[hydroxy-(1-phenylindazol-5-yl)methyl]phenol |
| SMILES | FCF.Oc1cccc(C(O)c2ccc3c(cnn3-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H16N2O2.CH2F2/c23-18-8-4-5-14(12-18)20(24)15-9-10-19-16(11-15)13-21-22(19)17-6-2-1-3-7-17;2-1-3/h1-13,20,23-24H;1H2 |
| InChIKey | MJFZXTKRNABSFC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |