C18H24F3NO — CID 143372421
(Z)-1,1,1-trifluoro-3-(4-methylpentylideneamino)-2-(4-methylphenyl)pent-3-en-2-ol (PubChem CID 143372421) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-3-(4-methylpentylideneamino)-2-(4-methylphenyl)pent-3-en-2-ol.
| Compound Name | (Z)-1,1,1-trifluoro-3-(4-methylpentylideneamino)-2-(4-methylphenyl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 143372421 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (Z)-1,1,1-trifluoro-3-(4-methylpentylideneamino)-2-(4-methylphenyl)pent-3-en-2-ol |
| SMILES | C/C=C(\N=C\CCC(C)C)C(O)(c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO/c1-5-16(22-12-6-7-13(2)3)17(23,18(19,20)21)15-10-8-14(4)9-11-15/h5,8-13,23H,6-7H2,1-4H3/b16-5-,22-12+ |
| InChIKey | REBCCQUBZDGIEI-WUCKSHPWSA-N |
| XLogP | 5.16 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|