C13H14N2O3 — CID 143375951
5-amino-1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one (PubChem CID 143375951) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-amino-1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one.
| Compound Name | 5-amino-1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one |
|---|---|
| PubChem CID | 143375951 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-amino-1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one |
| SMILES | Nc1cccc2c1ccc(=O)n2CC1OCCO1 |
| InChI | InChI=1S/C13H14N2O3/c14-10-2-1-3-11-9(10)4-5-12(16)15(11)8-13-17-6-7-18-13/h1-5,13H,6-8,14H2 |
| InChIKey | ONWLHOJASXKGED-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|