C23H34N2 — CID 143376063
1-[1-methyl-5-[6-(4-methylphenyl)hex-1-en-2-yl]pyrrol-2-yl]pentan-3-amine (PubChem CID 143376063) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-[1-methyl-5-[6-(4-methylphenyl)hex-1-en-2-yl]pyrrol-2-yl]pentan-3-amine.
| Compound Name | 1-[1-methyl-5-[6-(4-methylphenyl)hex-1-en-2-yl]pyrrol-2-yl]pentan-3-amine |
|---|---|
| PubChem CID | 143376063 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-[1-methyl-5-[6-(4-methylphenyl)hex-1-en-2-yl]pyrrol-2-yl]pentan-3-amine |
| SMILES | C=C(CCCCc1ccc(C)cc1)c1ccc(CCC(N)CC)n1C |
| InChI | InChI=1S/C23H34N2/c1-5-21(24)14-15-22-16-17-23(25(22)4)19(3)8-6-7-9-20-12-10-18(2)11-13-20/h10-13,16-17,21H,3,5-9,14-15,24H2,1-2,4H3 |
| InChIKey | PGRXNPLJIPGMOQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|