About (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene
(4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene (PubChem CID 143376124) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene.
Molecular Properties
| Compound Name | (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene |
| PubChem CID | 143376124 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene |
| SMILES | CCCc1ccc(COC)cc1.CCOc1ccc(CO)cc1 |
| InChI | InChI=1S/C11H16O.C9H12O2/c1-3-4-10-5-7-11(8-6-10)9-12-2;1-2-11-9-5-3-8(7-10)4-6-9/h5-8H,3-4,9H2,1-2H3;3-6,10H,2,7H2,1H3 |
| InChIKey | PMDMDUWXSHEWIQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene?
The IUPAC name of (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene (CID 143376124) is (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene.
What is the SMILES notation for (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene?
The canonical SMILES for (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene is CCCc1ccc(COC)cc1.CCOc1ccc(CO)cc1.
What is the InChIKey of (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene?
The InChIKey is PMDMDUWXSHEWIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C9H12O2/c1-3-4-10-5-7-11(8-6-10)9-12-2;1-2-11-9-5-3-8(7-10)4-6-9/h5-8H,3-4,9H2,1-2H3;3-6,10H,2,7H2,1H3.
What are the key properties of (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene?
(4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene has a molecular weight of 316.44 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl)methanol;1-(methoxymethyl)-4-propylbenzene is sourced from PubChem (CID 143376124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).