C16H36N2 — CID 143376353
bis(1,4-dimethylpiperidine);ethane (PubChem CID 143376353) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is bis(1,4-dimethylpiperidine);ethane.
| Compound Name | bis(1,4-dimethylpiperidine);ethane |
|---|---|
| PubChem CID | 143376353 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | bis(1,4-dimethylpiperidine);ethane |
| SMILES | CC.CC1CCN(C)CC1.CC1CCN(C)CC1 |
| InChI | InChI=1S/2C7H15N.C2H6/c2*1-7-3-5-8(2)6-4-7;1-2/h2*7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | XPOAZSYVVCYGDR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |