C13H24N2O2S — CID 143377798
(2Z,4Z)-N,6-dimethyl-5-(propylideneamino)octa-2,4-diene-4-sulfonamide (PubChem CID 143377798) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is (2Z,4Z)-N,6-dimethyl-5-(propylideneamino)octa-2,4-diene-4-sulfonamide.
| Compound Name | (2Z,4Z)-N,6-dimethyl-5-(propylideneamino)octa-2,4-diene-4-sulfonamide |
|---|---|
| PubChem CID | 143377798 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2Z,4Z)-N,6-dimethyl-5-(propylideneamino)octa-2,4-diene-4-sulfonamide |
| SMILES | C/C=C\C(=C(\N=C\CC)C(C)CC)S(=O)(=O)NC |
| InChI | InChI=1S/C13H24N2O2S/c1-6-9-12(18(16,17)14-5)13(11(4)8-3)15-10-7-2/h6,9-11,14H,7-8H2,1-5H3/b9-6-,13-12-,15-10+ |
| InChIKey | QLUKYQVAXLSECE-DEYPIITBSA-N |
| XLogP | 2.85 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|