C12H16N2O2S — CID 123907841
N-methyl-1-(3H-pyridin-2-ylidene)hexa-2,4-diene-1-sulfonamide (PubChem CID 123907841) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-methyl-1-(3H-pyridin-2-ylidene)hexa-2,4-diene-1-sulfonamide.
| Compound Name | N-methyl-1-(3H-pyridin-2-ylidene)hexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 123907841 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-methyl-1-(3H-pyridin-2-ylidene)hexa-2,4-diene-1-sulfonamide |
| SMILES | CC=CC=CC(=C1CC=CC=N1)S(=O)(=O)NC |
| InChI | InChI=1S/C12H16N2O2S/c1-3-4-5-9-12(17(15,16)13-2)11-8-6-7-10-14-11/h3-7,9-10,13H,8H2,1-2H3 |
| InChIKey | KMEZENGXCXHPDQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|